C25H18N4S — CID 137116079
3-[4-(5-methylthiophen-2-yl)-1H-indol-2-yl]-5-pyridin-4-yl-1H-indazole (PubChem CID 137116079) has the molecular formula C25H18N4S and a molecular weight of 406.51 g/mol. Its IUPAC name is 3-[4-(5-methylthiophen-2-yl)-1H-indol-2-yl]-5-pyridin-4-yl-1H-indazole.
| Compound Name | 3-[4-(5-methylthiophen-2-yl)-1H-indol-2-yl]-5-pyridin-4-yl-1H-indazole |
|---|---|
| PubChem CID | 137116079 |
| Molecular Formula | C25H18N4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 3-[4-(5-methylthiophen-2-yl)-1H-indol-2-yl]-5-pyridin-4-yl-1H-indazole |
| SMILES | Cc1ccc(-c2cccc3[nH]c(-c4n[nH]c5ccc(-c6ccncc6)cc45)cc23)s1 |
| InChI | InChI=1S/C25H18N4S/c1-15-5-8-24(30-15)18-3-2-4-21-19(18)14-23(27-21)25-20-13-17(6-7-22(20)28-29-25)16-9-11-26-12-10-16/h2-14,27H,1H3,(H,28,29) |
| InChIKey | OIEQAUPZPSVOSC-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |