C27H23N5O2 — CID 137308957
1-[[5-[3-[4-(furan-3-yl)-1H-indol-2-yl]-1H-indazol-5-yl]-3-pyridinyl]amino]propan-1-ol (PubChem CID 137308957) has the molecular formula C27H23N5O2 and a molecular weight of 449.51 g/mol. Its IUPAC name is 1-[[5-[3-[4-(furan-3-yl)-1H-indol-2-yl]-1H-indazol-5-yl]-3-pyridinyl]amino]propan-1-ol.
| Compound Name | 1-[[5-[3-[4-(furan-3-yl)-1H-indol-2-yl]-1H-indazol-5-yl]-3-pyridinyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 137308957 |
| Molecular Formula | C27H23N5O2 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 1-[[5-[3-[4-(furan-3-yl)-1H-indol-2-yl]-1H-indazol-5-yl]-3-pyridinyl]amino]propan-1-ol |
| SMILES | CCC(O)Nc1cncc(-c2ccc3[nH]nc(-c4cc5c(-c6ccoc6)cccc5[nH]4)c3c2)c1 |
| InChI | InChI=1S/C27H23N5O2/c1-2-26(33)29-19-10-18(13-28-14-19)16-6-7-24-22(11-16)27(32-31-24)25-12-21-20(17-8-9-34-15-17)4-3-5-23(21)30-25/h3-15,26,29-30,33H,2H2,1H3,(H,31,32) |
| InChIKey | MHPCCQVSONHANE-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|