C33H32FN5O2 — CID 137308960
1-[[5-[3-[4-(3-fluoro-5-methoxyphenyl)-1H-indol-2-yl]-1H-indazol-5-yl]-3-pyridinyl]amino]-3,3-dimethylbutan-1-ol (PubChem CID 137308960) has the molecular formula C33H32FN5O2 and a molecular weight of 549.65 g/mol. Its IUPAC name is 1-[[5-[3-[4-(3-fluoro-5-methoxyphenyl)-1H-indol-2-yl]-1H-indazol-5-yl]-3-pyridinyl]amino]-3,3-dimethylbutan-1-ol.
| Compound Name | 1-[[5-[3-[4-(3-fluoro-5-methoxyphenyl)-1H-indol-2-yl]-1H-indazol-5-yl]-3-pyridinyl]amino]-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 137308960 |
| Molecular Formula | C33H32FN5O2 |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | 1-[[5-[3-[4-(3-fluoro-5-methoxyphenyl)-1H-indol-2-yl]-1H-indazol-5-yl]-3-pyridinyl]amino]-3,3-dimethylbutan-1-ol |
| SMILES | COc1cc(F)cc(-c2cccc3[nH]c(-c4n[nH]c5ccc(-c6cncc(NC(O)CC(C)(C)C)c6)cc45)cc23)c1 |
| InChI | InChI=1S/C33H32FN5O2/c1-33(2,3)16-31(40)36-23-11-21(17-35-18-23)19-8-9-29-27(13-19)32(39-38-29)30-15-26-25(6-5-7-28(26)37-30)20-10-22(34)14-24(12-20)41-4/h5-15,17-18,31,36-37,40H,16H2,1-4H3,(H,38,39) |
| InChIKey | ZELCOFAZILBTDL-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|