C29H34N3O7Si — CID 137119277
CID 137119277 (PubChem CID 137119277) has the molecular formula C29H34N3O7Si and a molecular weight of 564.69 g/mol.
| Compound Name | CID 137119277 |
|---|---|
| PubChem CID | 137119277 |
| Molecular Formula | C29H34N3O7Si |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | — |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccc(OCCCCCCC(=O)NO)cc1c2[Si](C)C |
| InChI | InChI=1S/C29H34N3O7Si/c1-4-29(36)21-14-23-25-19(15-32(23)27(34)20(21)16-39-28(29)35)26(40(2)3)18-13-17(10-11-22(18)30-25)38-12-8-6-5-7-9-24(33)31-37/h10-11,13-14,36-37H,4-9,12,15-16H2,1-3H3,(H,31,33) |
| InChIKey | AOBNEJOPUXYCIH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|