C14H17ClN4 — CID 137119569
2-chloro-N-(5-cyclopropyl-1H-pyrazol-3-yl)-3-ethyl-1,4-dihydroazepin-7-imine (PubChem CID 137119569) has the molecular formula C14H17ClN4 and a molecular weight of 276.77 g/mol. Its IUPAC name is 2-chloro-N-(5-cyclopropyl-1H-pyrazol-3-yl)-3-ethyl-1,4-dihydroazepin-7-imine.
| Compound Name | 2-chloro-N-(5-cyclopropyl-1H-pyrazol-3-yl)-3-ethyl-1,4-dihydroazepin-7-imine |
|---|---|
| PubChem CID | 137119569 |
| Molecular Formula | C14H17ClN4 |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-chloro-N-(5-cyclopropyl-1H-pyrazol-3-yl)-3-ethyl-1,4-dihydroazepin-7-imine |
| SMILES | CCC1=C(Cl)N/C(=N/c2cc(C3CC3)[nH]n2)C=CC1 |
| InChI | InChI=1S/C14H17ClN4/c1-2-9-4-3-5-12(17-14(9)15)16-13-8-11(18-19-13)10-6-7-10/h3,5,8,10H,2,4,6-7H2,1H3,(H2,16,17,18,19) |
| InChIKey | NAYUTEZNQKPLGW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|