C22H22N4O4S — CID 137121098
(5Z)-2-(4-methoxyphenyl)imino-5-[(5-nitro-2-piperidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137121098) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is (5Z)-2-(4-methoxyphenyl)imino-5-[(5-nitro-2-piperidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-methoxyphenyl)imino-5-[(5-nitro-2-piperidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137121098 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | (5Z)-2-(4-methoxyphenyl)imino-5-[(5-nitro-2-piperidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/N=C2\NC(=O)/C(=C/c3cc([N+](=O)[O-])ccc3N3CCCCC3)S2)cc1 |
| InChI | InChI=1S/C22H22N4O4S/c1-30-18-8-5-16(6-9-18)23-22-24-21(27)20(31-22)14-15-13-17(26(28)29)7-10-19(15)25-11-3-2-4-12-25/h5-10,13-14H,2-4,11-12H2,1H3,(H,23,24,27)/b20-14- |
| InChIKey | QDWCUDVIZQQADT-ZHZULCJRSA-N |
| XLogP | 4.49 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|