C21H24N9O11P — CID 137123307
2-amino-9-[7-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-6,12,17-trihydroxy-12-oxo-2,4,8,11,13,16-hexaoxa-12λ5-phosphatricyclo[12.2.1.05,9]heptadecan-15-yl]-1H-purin-6-one (PubChem CID 137123307) has the molecular formula C21H24N9O11P and a molecular weight of 609.45 g/mol. Its IUPAC name is 2-amino-9-[7-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-6,12,17-trihydroxy-12-oxo-2,4,8,11,13,16-hexaoxa-12λ5-phosphatricyclo[12.2.1.05,9]heptadecan-15-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[7-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-6,12,17-trihydroxy-12-oxo-2,4,8,11,13,16-hexaoxa-12λ5-phosphatricyclo[12.2.1.05,9]heptadecan-15-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137123307 |
| Molecular Formula | C21H24N9O11P |
| Molecular Weight | 609.45 g/mol |
| Exact Mass | 609.13 |
| IUPAC Name | 2-amino-9-[7-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-6,12,17-trihydroxy-12-oxo-2,4,8,11,13,16-hexaoxa-12λ5-phosphatricyclo[12.2.1.05,9]heptadecan-15-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2C2OC3OCOC4C(COP(=O)(O)OC2C3O)OC(n2ccc3c(N)ncnc32)C4O)c(=O)[nH]1 |
| InChI | InChI=1S/C21H24N9O11P/c22-14-7-1-2-29(15(7)25-4-24-14)18-10(31)12-8(39-18)3-38-42(34,35)41-13-11(32)20(37-6-36-12)40-19(13)30-5-26-9-16(30)27-21(23)28-17(9)33/h1-2,4-5,8,10-13,18-20,31-32H,3,6H2,(H,34,35)(H2,22,24,25)(H3,23,27,28,33) |
| InChIKey | YLZIGXIZLYPMHM-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 279.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.45 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|