C21H25N10O10P — CID 137149050
2-amino-9-[(5S,6R,7R,9S,14R,15R,17S)-7-(6-aminopurin-9-yl)-6,12,17-trihydroxy-12-oxo-2,8,11,13,16-pentaoxa-12λ5-phosphatricyclo[12.2.1.05,9]heptadecan-15-yl]-1H-purin-6-one (PubChem CID 137149050) has the molecular formula C21H25N10O10P and a molecular weight of 608.47 g/mol. Its IUPAC name is 2-amino-9-[(5S,6R,7R,9S,14R,15R,17S)-7-(6-aminopurin-9-yl)-6,12,17-trihydroxy-12-oxo-2,8,11,13,16-pentaoxa-12λ5-phosphatricyclo[12.2.1.05,9]heptadecan-15-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(5S,6R,7R,9S,14R,15R,17S)-7-(6-aminopurin-9-yl)-6,12,17-trihydroxy-12-oxo-2,8,11,13,16-pentaoxa-12λ5-phosphatricyclo[12.2.1.05,9]heptadecan-15-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137149050 |
| Molecular Formula | C21H25N10O10P |
| Molecular Weight | 608.47 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | 2-amino-9-[(5S,6R,7R,9S,14R,15R,17S)-7-(6-aminopurin-9-yl)-6,12,17-trihydroxy-12-oxo-2,8,11,13,16-pentaoxa-12λ5-phosphatricyclo[12.2.1.05,9]heptadecan-15-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@@H]2OC3OCC[C@H]4[C@@H](O)[C@H](n5cnc6c(N)ncnc65)O[C@@H]4COP(=O)(O)O[C@@H]2[C@@H]3O)c(=O)[nH]1 |
| InChI | InChI=1S/C21H25N10O10P/c22-14-9-15(25-4-24-14)30(5-26-9)18-11(32)7-1-2-37-20-12(33)13(41-42(35,36)38-3-8(7)39-18)19(40-20)31-6-27-10-16(31)28-21(23)29-17(10)34/h4-8,11-13,18-20,32-33H,1-3H2,(H,35,36)(H2,22,24,25)(H3,23,28,29,34)/t7-,8-,11-,12+,13-,18-,19-,20?/m1/s1 |
| InChIKey | LUFPLPKHYJSANA-XPRBCBANSA-N |
| XLogP | -1.86 |
| TPSA | 283.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.47 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|