C21H26N4O2 — CID 137125165
(3aS,7aR)-N-[3-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-1,2,3,4,5,6,7,7a-octahydroisoindole-3a-carboxamide (PubChem CID 137125165) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is (3aS,7aR)-N-[3-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-1,2,3,4,5,6,7,7a-octahydroisoindole-3a-carboxamide.
| Compound Name | (3aS,7aR)-N-[3-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-1,2,3,4,5,6,7,7a-octahydroisoindole-3a-carboxamide |
|---|---|
| PubChem CID | 137125165 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (3aS,7aR)-N-[3-(4-ethyl-6-oxo-1H-pyrimidin-2-yl)phenyl]-1,2,3,4,5,6,7,7a-octahydroisoindole-3a-carboxamide |
| SMILES | CCc1cc(=O)[nH]c(-c2cccc(NC(=O)[C@@]34CCCC[C@H]3CNC4)c2)n1 |
| InChI | InChI=1S/C21H26N4O2/c1-2-16-11-18(26)25-19(23-16)14-6-5-8-17(10-14)24-20(27)21-9-4-3-7-15(21)12-22-13-21/h5-6,8,10-11,15,22H,2-4,7,9,12-13H2,1H3,(H,24,27)(H,23,25,26)/t15-,21+/m0/s1 |
| InChIKey | UGAAFCIEMQQLPH-YCRPNKLZSA-N |
| XLogP | 2.72 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |