C12H18F3N3 — CID 137128109
3,4-dimethyl-2-propan-2-ylimino-6-(trifluoromethyl)-1,3-dihydroazepin-5-amine (PubChem CID 137128109) has the molecular formula C12H18F3N3 and a molecular weight of 261.29 g/mol. Its IUPAC name is 3,4-dimethyl-2-propan-2-ylimino-6-(trifluoromethyl)-1,3-dihydroazepin-5-amine.
| Compound Name | 3,4-dimethyl-2-propan-2-ylimino-6-(trifluoromethyl)-1,3-dihydroazepin-5-amine |
|---|---|
| PubChem CID | 137128109 |
| Molecular Formula | C12H18F3N3 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3,4-dimethyl-2-propan-2-ylimino-6-(trifluoromethyl)-1,3-dihydroazepin-5-amine |
| SMILES | CC1=C(N)C(C(F)(F)F)=CN/C(=N\C(C)C)C1C |
| InChI | InChI=1S/C12H18F3N3/c1-6(2)18-11-8(4)7(3)10(16)9(5-17-11)12(13,14)15/h5-6,8H,16H2,1-4H3,(H,17,18) |
| InChIKey | SWWIYKGAMSLFPM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|