C22H19ClN4OS — CID 137129024
(5Z)-2-(5-chloro-2-methylphenyl)imino-5-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137129024) has the molecular formula C22H19ClN4OS and a molecular weight of 422.94 g/mol. Its IUPAC name is (5Z)-2-(5-chloro-2-methylphenyl)imino-5-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(5-chloro-2-methylphenyl)imino-5-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137129024 |
| Molecular Formula | C22H19ClN4OS |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | (5Z)-2-(5-chloro-2-methylphenyl)imino-5-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(Cl)cc1/N=C1/NC(=O)/C(=C/c2cc(C)n(-c3ccccn3)c2C)S1 |
| InChI | InChI=1S/C22H19ClN4OS/c1-13-7-8-17(23)12-18(13)25-22-26-21(28)19(29-22)11-16-10-14(2)27(15(16)3)20-6-4-5-9-24-20/h4-12H,1-3H3,(H,25,26,28)/b19-11- |
| InChIKey | ZGIZPTFQNRCXCB-ODLFYWEKSA-N |
| XLogP | 5.34 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|