C22H30N4O4 — CID 137129813
N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[2-[(3-methoxyphenyl)methyl-methylamino]ethyl-methylamino]acetamide (PubChem CID 137129813) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[2-[(3-methoxyphenyl)methyl-methylamino]ethyl-methylamino]acetamide.
| Compound Name | N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[2-[(3-methoxyphenyl)methyl-methylamino]ethyl-methylamino]acetamide |
|---|---|
| PubChem CID | 137129813 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-2-[2-[(3-methoxyphenyl)methyl-methylamino]ethyl-methylamino]acetamide |
| SMILES | COc1cccc(CN(C)CCN(C)CC(=O)N/N=C/c2cccc(OC)c2O)c1 |
| InChI | InChI=1S/C22H30N4O4/c1-25(15-17-7-5-9-19(13-17)29-3)11-12-26(2)16-21(27)24-23-14-18-8-6-10-20(30-4)22(18)28/h5-10,13-14,28H,11-12,15-16H2,1-4H3,(H,24,27)/b23-14+ |
| InChIKey | XYXJCTUWOXYNRK-OEAKJJBVSA-N |
| XLogP | 1.92 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|