C28H28BrN3O5S — CID 137130730
ethyl (5Z)-5-[[5-bromo-1-[2-(2-methoxyethylamino)-2-oxoethyl]indol-3-yl]methylidene]-4-hydroxy-2-(4-methylphenyl)iminothiophene-3-carboxylate (PubChem CID 137130730) has the molecular formula C28H28BrN3O5S and a molecular weight of 598.52 g/mol. Its IUPAC name is ethyl (5Z)-5-[[5-bromo-1-[2-(2-methoxyethylamino)-2-oxoethyl]indol-3-yl]methylidene]-4-hydroxy-2-(4-methylphenyl)iminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[[5-bromo-1-[2-(2-methoxyethylamino)-2-oxoethyl]indol-3-yl]methylidene]-4-hydroxy-2-(4-methylphenyl)iminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137130730 |
| Molecular Formula | C28H28BrN3O5S |
| Molecular Weight | 598.52 g/mol |
| Exact Mass | 597.09 |
| IUPAC Name | ethyl (5Z)-5-[[5-bromo-1-[2-(2-methoxyethylamino)-2-oxoethyl]indol-3-yl]methylidene]-4-hydroxy-2-(4-methylphenyl)iminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cn(CC(=O)NCCOC)c3ccc(Br)cc23)S/C1=N\c1ccc(C)cc1 |
| InChI | InChI=1S/C28H28BrN3O5S/c1-4-37-28(35)25-26(34)23(38-27(25)31-20-8-5-17(2)6-9-20)13-18-15-32(16-24(33)30-11-12-36-3)22-10-7-19(29)14-21(18)22/h5-10,13-15,34H,4,11-12,16H2,1-3H3,(H,30,33)/b23-13-,31-27- |
| InChIKey | BRKINHZRJRSNBG-RTVQRGGNSA-N |
| XLogP | 5.67 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|