C28H29N3O6S — CID 137130946
ethyl (5Z)-4-hydroxy-5-[[1-[2-(2-methoxyethylamino)-2-oxoethyl]indol-3-yl]methylidene]-2-(4-methoxyphenyl)iminothiophene-3-carboxylate (PubChem CID 137130946) has the molecular formula C28H29N3O6S and a molecular weight of 535.62 g/mol. Its IUPAC name is ethyl (5Z)-4-hydroxy-5-[[1-[2-(2-methoxyethylamino)-2-oxoethyl]indol-3-yl]methylidene]-2-(4-methoxyphenyl)iminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-4-hydroxy-5-[[1-[2-(2-methoxyethylamino)-2-oxoethyl]indol-3-yl]methylidene]-2-(4-methoxyphenyl)iminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137130946 |
| Molecular Formula | C28H29N3O6S |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | ethyl (5Z)-4-hydroxy-5-[[1-[2-(2-methoxyethylamino)-2-oxoethyl]indol-3-yl]methylidene]-2-(4-methoxyphenyl)iminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cn(CC(=O)NCCOC)c3ccccc23)S/C1=N\c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H29N3O6S/c1-4-37-28(34)25-26(33)23(38-27(25)30-19-9-11-20(36-3)12-10-19)15-18-16-31(17-24(32)29-13-14-35-2)22-8-6-5-7-21(18)22/h5-12,15-16,33H,4,13-14,17H2,1-3H3,(H,29,32)/b23-15-,30-27- |
| InChIKey | FEXDVBNRJVTGRI-KWSKTOGSSA-N |
| XLogP | 4.61 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|