C30H25ClN2O4S — CID 137130925
ethyl (5Z)-5-[[1-[2-(4-chlorophenoxy)ethyl]indol-3-yl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate (PubChem CID 137130925) has the molecular formula C30H25ClN2O4S and a molecular weight of 545.06 g/mol. Its IUPAC name is ethyl (5Z)-5-[[1-[2-(4-chlorophenoxy)ethyl]indol-3-yl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-5-[[1-[2-(4-chlorophenoxy)ethyl]indol-3-yl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 137130925 |
| Molecular Formula | C30H25ClN2O4S |
| Molecular Weight | 545.06 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | ethyl (5Z)-5-[[1-[2-(4-chlorophenoxy)ethyl]indol-3-yl]methylidene]-4-hydroxy-2-phenyliminothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cn(CCOc3ccc(Cl)cc3)c3ccccc23)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C30H25ClN2O4S/c1-2-36-30(35)27-28(34)26(38-29(27)32-22-8-4-3-5-9-22)18-20-19-33(25-11-7-6-10-24(20)25)16-17-37-23-14-12-21(31)13-15-23/h3-15,18-19,34H,2,16-17H2,1H3/b26-18-,32-29- |
| InChIKey | SSFHRLXCHUHINO-HNMAGBENSA-N |
| XLogP | 7.57 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.06 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|