C20H28N9O10P — CID 137131492
[(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-4-methyloxolan-2-yl]methyl [(2R,4S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-2-(hydroxymethyl)-4-methyloxolan-3-yl] hydrogen phosphate (PubChem CID 137131492) has the molecular formula C20H28N9O10P and a molecular weight of 585.47 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-4-methyloxolan-2-yl]methyl [(2R,4S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-2-(hydroxymethyl)-4-methyloxolan-3-yl] hydrogen phosphate.
| Compound Name | [(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-4-methyloxolan-2-yl]methyl [(2R,4S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-2-(hydroxymethyl)-4-methyloxolan-3-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 137131492 |
| Molecular Formula | C20H28N9O10P |
| Molecular Weight | 585.47 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | [(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-4-methyloxolan-2-yl]methyl [(2R,4S,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-2-(hydroxymethyl)-4-methyloxolan-3-yl] hydrogen phosphate |
| SMILES | C[C@H]1C(OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(N)nc43)[C@@H](C)C2O)[C@@H](CO)O[C@H]1n1cnc(N)nc1=O |
| InChI | InChI=1S/C20H28N9O10P/c1-7-12(31)10(38-16(7)28-5-23-11-14(28)25-19(22)26-15(11)32)4-36-40(34,35)39-13-8(2)17(37-9(13)3-30)29-6-24-18(21)27-20(29)33/h5-10,12-13,16-17,30-31H,3-4H2,1-2H3,(H,34,35)(H2,21,27,33)(H3,22,25,26,32)/t7-,8-,9+,10+,12?,13?,16+,17+/m0/s1 |
| InChIKey | XAAARCLNHJHUKG-KZOKTLFWSA-N |
| XLogP | -2.14 |
| TPSA | 278.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.47 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|