C20H28N9O12P — CID 144545341
[(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methyl [(2R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] hydrogen phosphate (PubChem CID 144545341) has the molecular formula C20H28N9O12P and a molecular weight of 617.47 g/mol. Its IUPAC name is [(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methyl [(2R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] hydrogen phosphate.
| Compound Name | [(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methyl [(2R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 144545341 |
| Molecular Formula | C20H28N9O12P |
| Molecular Weight | 617.47 g/mol |
| Exact Mass | 617.16 |
| IUPAC Name | [(2R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxy-4-methoxyoxolan-2-yl]methyl [(2R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-2-(hydroxymethyl)-4-methoxyoxolan-3-yl] hydrogen phosphate |
| SMILES | COC1C(OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]c(N)nc43)C(OC)C2O)[C@@H](CO)O[C@H]1n1cnc(N)nc1=O |
| InChI | InChI=1S/C20H28N9O12P/c1-36-12-10(31)8(40-16(12)28-5-23-9-14(28)25-19(22)26-15(9)32)4-38-42(34,35)41-11-7(3-30)39-17(13(11)37-2)29-6-24-18(21)27-20(29)33/h5-8,10-13,16-17,30-31H,3-4H2,1-2H3,(H,34,35)(H2,21,27,33)(H3,22,25,26,32)/t7-,8-,10?,11?,12?,13?,16-,17-/m1/s1 |
| InChIKey | DPVYBQSRVGVRNM-LINPEGASSA-N |
| XLogP | -3.38 |
| TPSA | 296.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.47 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|