C24H29N7O3 — CID 137131599
5-[4-amino-5-(1-aminoethyl)-2-hydroxyphenyl]-N-cyclopropyl-4-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 137131599) has the molecular formula C24H29N7O3 and a molecular weight of 463.54 g/mol. Its IUPAC name is 5-[4-amino-5-(1-aminoethyl)-2-hydroxyphenyl]-N-cyclopropyl-4-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-[4-amino-5-(1-aminoethyl)-2-hydroxyphenyl]-N-cyclopropyl-4-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 137131599 |
| Molecular Formula | C24H29N7O3 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 5-[4-amino-5-(1-aminoethyl)-2-hydroxyphenyl]-N-cyclopropyl-4-(4-morpholin-4-ylphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | CC(N)c1cc(-c2nnc(C(=O)NC3CC3)n2-c2ccc(N3CCOCC3)cc2)c(O)cc1N |
| InChI | InChI=1S/C24H29N7O3/c1-14(25)18-12-19(21(32)13-20(18)26)22-28-29-23(24(33)27-15-2-3-15)31(22)17-6-4-16(5-7-17)30-8-10-34-11-9-30/h4-7,12-15,32H,2-3,8-11,25-26H2,1H3,(H,27,33) |
| InChIKey | NECCCDUVBXXHMF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 144.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|