C27H28N4O4 — CID 136619680
4-[5-(3-hydroxyphenyl)-4-(4-morpholin-4-ylphenyl)-1,2,4-triazol-3-yl]-6-propan-2-ylbenzene-1,3-diol (PubChem CID 136619680) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 4-[5-(3-hydroxyphenyl)-4-(4-morpholin-4-ylphenyl)-1,2,4-triazol-3-yl]-6-propan-2-ylbenzene-1,3-diol.
| Compound Name | 4-[5-(3-hydroxyphenyl)-4-(4-morpholin-4-ylphenyl)-1,2,4-triazol-3-yl]-6-propan-2-ylbenzene-1,3-diol |
|---|---|
| PubChem CID | 136619680 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 4-[5-(3-hydroxyphenyl)-4-(4-morpholin-4-ylphenyl)-1,2,4-triazol-3-yl]-6-propan-2-ylbenzene-1,3-diol |
| SMILES | CC(C)c1cc(-c2nnc(-c3cccc(O)c3)n2-c2ccc(N3CCOCC3)cc2)c(O)cc1O |
| InChI | InChI=1S/C27H28N4O4/c1-17(2)22-15-23(25(34)16-24(22)33)27-29-28-26(18-4-3-5-21(32)14-18)31(27)20-8-6-19(7-9-20)30-10-12-35-13-11-30/h3-9,14-17,32-34H,10-13H2,1-2H3 |
| InChIKey | KEXKFMUQQSCGAN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|