C18H19BrN2O2S2 — CID 1371348
(5Z)-5-[(3-bromophenyl)methylidene]-3-(4-oxo-4-pyrrolidin-1-ylbutyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 1371348) has the molecular formula C18H19BrN2O2S2 and a molecular weight of 439.40 g/mol. Its IUPAC name is (5Z)-5-[(3-bromophenyl)methylidene]-3-(4-oxo-4-pyrrolidin-1-ylbutyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3-bromophenyl)methylidene]-3-(4-oxo-4-pyrrolidin-1-ylbutyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1371348 |
| Molecular Formula | C18H19BrN2O2S2 |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | (5Z)-5-[(3-bromophenyl)methylidene]-3-(4-oxo-4-pyrrolidin-1-ylbutyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C(CCCN1C(=O)/C(=C/c2cccc(Br)c2)SC1=S)N1CCCC1 |
| InChI | InChI=1S/C18H19BrN2O2S2/c19-14-6-3-5-13(11-14)12-15-17(23)21(18(24)25-15)10-4-7-16(22)20-8-1-2-9-20/h3,5-6,11-12H,1-2,4,7-10H2/b15-12- |
| InChIKey | UUBGRMFJYFMBEH-QINSGFPZSA-N |
| XLogP | 4.05 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|