C23H20FN3O3 — CID 137136144
(4Z)-4-[1-(5,5-dimethyl-2-oxo-4-phenylfuran-3-yl)ethylidene]-2-(2-fluoroanilino)-1H-imidazol-5-one (PubChem CID 137136144) has the molecular formula C23H20FN3O3 and a molecular weight of 405.43 g/mol. Its IUPAC name is (4Z)-4-[1-(5,5-dimethyl-2-oxo-4-phenylfuran-3-yl)ethylidene]-2-(2-fluoroanilino)-1H-imidazol-5-one.
| Compound Name | (4Z)-4-[1-(5,5-dimethyl-2-oxo-4-phenylfuran-3-yl)ethylidene]-2-(2-fluoroanilino)-1H-imidazol-5-one |
|---|---|
| PubChem CID | 137136144 |
| Molecular Formula | C23H20FN3O3 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (4Z)-4-[1-(5,5-dimethyl-2-oxo-4-phenylfuran-3-yl)ethylidene]-2-(2-fluoroanilino)-1H-imidazol-5-one |
| SMILES | C/C(C1=C(c2ccccc2)C(C)(C)OC1=O)=C1/N=C(Nc2ccccc2F)NC1=O |
| InChI | InChI=1S/C23H20FN3O3/c1-13(17-18(14-9-5-4-6-10-14)23(2,3)30-21(17)29)19-20(28)27-22(26-19)25-16-12-8-7-11-15(16)24/h4-12H,1-3H3,(H2,25,26,27,28)/b19-13- |
| InChIKey | PYIRNAWUVJYOSZ-UYRXBGFRSA-N |
| XLogP | 3.79 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|