C25H17BrFN3OS — CID 137136603
(5E)-2-(4-bromophenyl)imino-5-[[1-[(3-fluorophenyl)methyl]indol-5-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137136603) has the molecular formula C25H17BrFN3OS and a molecular weight of 506.40 g/mol. Its IUPAC name is (5E)-2-(4-bromophenyl)imino-5-[[1-[(3-fluorophenyl)methyl]indol-5-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(4-bromophenyl)imino-5-[[1-[(3-fluorophenyl)methyl]indol-5-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137136603 |
| Molecular Formula | C25H17BrFN3OS |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 505.03 |
| IUPAC Name | (5E)-2-(4-bromophenyl)imino-5-[[1-[(3-fluorophenyl)methyl]indol-5-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2ccc(Br)cc2)S/C1=C/c1ccc2c(ccn2Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C25H17BrFN3OS/c26-19-5-7-21(8-6-19)28-25-29-24(31)23(32-25)14-16-4-9-22-18(12-16)10-11-30(22)15-17-2-1-3-20(27)13-17/h1-14H,15H2,(H,28,29,31)/b23-14+ |
| InChIKey | YRTHNUCZQLVPLM-OEAKJJBVSA-N |
| XLogP | 6.48 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|