C22H22BrN5O2 — CID 137137667
5-bromo-3-[3-(2-piperazin-1-ylethoxyimino)indol-2-yl]-1H-indol-2-ol (PubChem CID 137137667) has the molecular formula C22H22BrN5O2 and a molecular weight of 468.36 g/mol. Its IUPAC name is 5-bromo-3-[3-(2-piperazin-1-ylethoxyimino)indol-2-yl]-1H-indol-2-ol.
| Compound Name | 5-bromo-3-[3-(2-piperazin-1-ylethoxyimino)indol-2-yl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 137137667 |
| Molecular Formula | C22H22BrN5O2 |
| Molecular Weight | 468.36 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 5-bromo-3-[3-(2-piperazin-1-ylethoxyimino)indol-2-yl]-1H-indol-2-ol |
| SMILES | Oc1[nH]c2ccc(Br)cc2c1C1=Nc2ccccc2C1=NOCCN1CCNCC1 |
| InChI | InChI=1S/C22H22BrN5O2/c23-14-5-6-18-16(13-14)19(22(29)26-18)21-20(15-3-1-2-4-17(15)25-21)27-30-12-11-28-9-7-24-8-10-28/h1-6,13,24,26,29H,7-12H2 |
| InChIKey | DPDVEOGWPLEOAN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|