C28H28ClN5O3 — CID 137138564
7-[3-(3-chloropropanoylamino)cyclohexa-1,3-dien-1-yl]-2-(4-phenoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 137138564) has the molecular formula C28H28ClN5O3 and a molecular weight of 518.02 g/mol. Its IUPAC name is 7-[3-(3-chloropropanoylamino)cyclohexa-1,3-dien-1-yl]-2-(4-phenoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 7-[3-(3-chloropropanoylamino)cyclohexa-1,3-dien-1-yl]-2-(4-phenoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 137138564 |
| Molecular Formula | C28H28ClN5O3 |
| Molecular Weight | 518.02 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 7-[3-(3-chloropropanoylamino)cyclohexa-1,3-dien-1-yl]-2-(4-phenoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | NC(=O)c1c(-c2ccc(Oc3ccccc3)cc2)nn2c1NCCC2C1=CC(NC(=O)CCCl)=CCC1 |
| InChI | InChI=1S/C28H28ClN5O3/c29-15-13-24(35)32-20-6-4-5-19(17-20)23-14-16-31-28-25(27(30)36)26(33-34(23)28)18-9-11-22(12-10-18)37-21-7-2-1-3-8-21/h1-3,6-12,17,23,31H,4-5,13-16H2,(H2,30,36)(H,32,35) |
| InChIKey | LPXGDOAEEJHALN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.02 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|