C15H23N5O3 — CID 137141108
6-[(6-oxo-4-propan-2-yl-1H-pyrimidin-2-yl)carbamoylamino]hexyl cyanate (PubChem CID 137141108) has the molecular formula C15H23N5O3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 6-[(6-oxo-4-propan-2-yl-1H-pyrimidin-2-yl)carbamoylamino]hexyl cyanate.
| Compound Name | 6-[(6-oxo-4-propan-2-yl-1H-pyrimidin-2-yl)carbamoylamino]hexyl cyanate |
|---|---|
| PubChem CID | 137141108 |
| Molecular Formula | C15H23N5O3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 6-[(6-oxo-4-propan-2-yl-1H-pyrimidin-2-yl)carbamoylamino]hexyl cyanate |
| SMILES | CC(C)c1cc(=O)[nH]c(NC(=O)NCCCCCCOC#N)n1 |
| InChI | InChI=1S/C15H23N5O3/c1-11(2)12-9-13(21)19-14(18-12)20-15(22)17-7-5-3-4-6-8-23-10-16/h9,11H,3-8H2,1-2H3,(H3,17,18,19,20,21,22) |
| InChIKey | BHSXPKOYNVUZEI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|