C27H42N2O2Si2 — CID 137143376
2-ethyl-6-[3-[(3-ethyl-2-hydroxy-5-trimethylsilylphenyl)methylideneamino]propyliminomethyl]-4-trimethylsilylphenol (PubChem CID 137143376) has the molecular formula C27H42N2O2Si2 and a molecular weight of 482.82 g/mol. Its IUPAC name is 2-ethyl-6-[3-[(3-ethyl-2-hydroxy-5-trimethylsilylphenyl)methylideneamino]propyliminomethyl]-4-trimethylsilylphenol.
| Compound Name | 2-ethyl-6-[3-[(3-ethyl-2-hydroxy-5-trimethylsilylphenyl)methylideneamino]propyliminomethyl]-4-trimethylsilylphenol |
|---|---|
| PubChem CID | 137143376 |
| Molecular Formula | C27H42N2O2Si2 |
| Molecular Weight | 482.82 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | 2-ethyl-6-[3-[(3-ethyl-2-hydroxy-5-trimethylsilylphenyl)methylideneamino]propyliminomethyl]-4-trimethylsilylphenol |
| SMILES | CCc1cc([Si](C)(C)C)cc(/C=N/CCC/N=C/c2cc([Si](C)(C)C)cc(CC)c2O)c1O |
| InChI | InChI=1S/C27H42N2O2Si2/c1-9-20-14-24(32(3,4)5)16-22(26(20)30)18-28-12-11-13-29-19-23-17-25(33(6,7)8)15-21(10-2)27(23)31/h14-19,30-31H,9-13H2,1-8H3/b28-18+,29-19+ |
| InChIKey | DELVMPIFJVOZAE-UOSOPFLXSA-N |
| XLogP | 5.24 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.82 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|