methyl 4H-pyrrolo[2,3-f]quinoxaline-6-carboxylate

C12H9N3O2 — CID 137147104

IUPACmethyl 4H-pyrrolo[2,3-f]quinoxaline-6-carboxylate
SMILESCOC(=O)c1cc2[nH]ccnc2c2nccc12
InChIInChI=1S/C12H9N3O2/c1-17-12(16)8-6-9-11(15-5-4-13-9)10-7(8)2-3-14-10/h2-6,13H,1H3
InChIKeyRUIQUKCFRANGEG-UHFFFAOYSA-N
MW227.22 g/mol
LogP1.90
Rot. Bonds1

About methyl 4H-pyrrolo[2,3-f]quinoxaline-6-carboxylate

methyl 4H-pyrrolo[2,3-f]quinoxaline-6-carboxylate (PubChem CID 137147104) has the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. Its IUPAC name is methyl 4H-pyrrolo[2,3-f]quinoxaline-6-carboxylate.

Molecular Properties

Compound Namemethyl 4H-pyrrolo[2,3-f]quinoxaline-6-carboxylate
PubChem CID137147104
Molecular FormulaC12H9N3O2
Molecular Weight227.22 g/mol
Exact Mass227.07
IUPAC Namemethyl 4H-pyrrolo[2,3-f]quinoxaline-6-carboxylate
SMILESCOC(=O)c1cc2[nH]ccnc2c2nccc12
InChIInChI=1S/C12H9N3O2/c1-17-12(16)8-6-9-11(15-5-4-13-9)10-7(8)2-3-14-10/h2-6,13H,1H3
InChIKeyRUIQUKCFRANGEG-UHFFFAOYSA-N
XLogP1.90
TPSA67.87 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.22
LogP ≤ 51.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 4H-pyrrolo[2,3-f]quinoxaline-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4H-pyrrolo[2,3-f]quinoxaline-6-carboxylate?
The IUPAC name of methyl 4H-pyrrolo[2,3-f]quinoxaline-6-carboxylate (CID 137147104) is methyl 4H-pyrrolo[2,3-f]quinoxaline-6-carboxylate.
What is the SMILES notation for methyl 4H-pyrrolo[2,3-f]quinoxaline-6-carboxylate?
The canonical SMILES for methyl 4H-pyrrolo[2,3-f]quinoxaline-6-carboxylate is COC(=O)c1cc2[nH]ccnc2c2nccc12.
What is the InChIKey of methyl 4H-pyrrolo[2,3-f]quinoxaline-6-carboxylate?
The InChIKey is RUIQUKCFRANGEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O2/c1-17-12(16)8-6-9-11(15-5-4-13-9)10-7(8)2-3-14-10/h2-6,13H,1H3.
What are the key properties of methyl 4H-pyrrolo[2,3-f]quinoxaline-6-carboxylate?
methyl 4H-pyrrolo[2,3-f]quinoxaline-6-carboxylate has a molecular weight of 227.22 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4H-pyrrolo[2,3-f]quinoxaline-6-carboxylate is sourced from PubChem (CID 137147104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).