C13H9N3O3 — CID 50942143
methyl 5-oxo-6H-pyrazino[2,3-c]quinoline-8-carboxylate (PubChem CID 50942143) has the molecular formula C13H9N3O3 and a molecular weight of 255.23 g/mol. Its IUPAC name is methyl 5-oxo-6H-pyrazino[2,3-c]quinoline-8-carboxylate.
| Compound Name | methyl 5-oxo-6H-pyrazino[2,3-c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 50942143 |
| Molecular Formula | C13H9N3O3 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | methyl 5-oxo-6H-pyrazino[2,3-c]quinoline-8-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[nH]c(=O)c1nccnc12 |
| InChI | InChI=1S/C13H9N3O3/c1-19-13(18)7-2-3-8-9(6-7)16-12(17)11-10(8)14-4-5-15-11/h2-6H,1H3,(H,16,17) |
| InChIKey | ZLMYHNGPVKEAMJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|