C18H19N3O3 — CID 137147857
2-butan-2-yl-4-methyl-6-(3-nitrophenyl)pyrrolo[3,4-c]pyridin-3-ol (PubChem CID 137147857) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 2-butan-2-yl-4-methyl-6-(3-nitrophenyl)pyrrolo[3,4-c]pyridin-3-ol.
| Compound Name | 2-butan-2-yl-4-methyl-6-(3-nitrophenyl)pyrrolo[3,4-c]pyridin-3-ol |
|---|---|
| PubChem CID | 137147857 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-butan-2-yl-4-methyl-6-(3-nitrophenyl)pyrrolo[3,4-c]pyridin-3-ol |
| SMILES | CCC(C)n1cc2cc(-c3cccc([N+](=O)[O-])c3)nc(C)c2c1O |
| InChI | InChI=1S/C18H19N3O3/c1-4-11(2)20-10-14-9-16(19-12(3)17(14)18(20)22)13-6-5-7-15(8-13)21(23)24/h5-11,22H,4H2,1-3H3 |
| InChIKey | SXEGKONRAIUNAW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|