C17H27NO5 — CID 137151519
2-(N-ethyl-C-methylcarbonimidoyl)-6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenol (PubChem CID 137151519) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-(N-ethyl-C-methylcarbonimidoyl)-6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenol.
| Compound Name | 2-(N-ethyl-C-methylcarbonimidoyl)-6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenol |
|---|---|
| PubChem CID | 137151519 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-(N-ethyl-C-methylcarbonimidoyl)-6-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenol |
| SMILES | CC/N=C(\C)c1cccc(OCCOCCOCCOC)c1O |
| InChI | InChI=1S/C17H27NO5/c1-4-18-14(2)15-6-5-7-16(17(15)19)23-13-12-22-11-10-21-9-8-20-3/h5-7,19H,4,8-13H2,1-3H3/b18-14+ |
| InChIKey | LCASLGFVLRUXLV-NBVRZTHBSA-N |
| XLogP | 2.28 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|