C10H12N2O — CID 137152211
6-cyclopropyl-3-methanimidoyl-4-methyl-1H-pyridin-2-one (PubChem CID 137152211) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 6-cyclopropyl-3-methanimidoyl-4-methyl-1H-pyridin-2-one.
| Compound Name | 6-cyclopropyl-3-methanimidoyl-4-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 137152211 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 6-cyclopropyl-3-methanimidoyl-4-methyl-1H-pyridin-2-one |
| SMILES | [H]/N=C/c1c(C)cc(C2CC2)[nH]c1=O |
| InChI | InChI=1S/C10H12N2O/c1-6-4-9(7-2-3-7)12-10(13)8(6)5-11/h4-5,7,11H,2-3H2,1H3,(H,12,13)/b11-5+ |
| InChIKey | ADTCAYVIEIYCAU-VZUCSPMQSA-N |
| XLogP | 1.56 |
| TPSA | 56.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|