C14H10N4O4 — CID 137152440
2-[(4-nitrophenoxy)methyl]-3H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 137152440) has the molecular formula C14H10N4O4 and a molecular weight of 298.26 g/mol. Its IUPAC name is 2-[(4-nitrophenoxy)methyl]-3H-pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-[(4-nitrophenoxy)methyl]-3H-pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137152440 |
| Molecular Formula | C14H10N4O4 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-[(4-nitrophenoxy)methyl]-3H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(COc2ccc([N+](=O)[O-])cc2)nc2cnccc12 |
| InChI | InChI=1S/C14H10N4O4/c19-14-11-5-6-15-7-12(11)16-13(17-14)8-22-10-3-1-9(2-4-10)18(20)21/h1-7H,8H2,(H,16,17,19) |
| InChIKey | OCHWWRYWEPXXDV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|