C24H21N5O2 — CID 167444503
2-[[4-[(Z)-1-amino-3-methylimino-2-pyridin-4-ylprop-1-enyl]phenoxy]methyl]-3H-quinazolin-4-one (PubChem CID 167444503) has the molecular formula C24H21N5O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 2-[[4-[(Z)-1-amino-3-methylimino-2-pyridin-4-ylprop-1-enyl]phenoxy]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[4-[(Z)-1-amino-3-methylimino-2-pyridin-4-ylprop-1-enyl]phenoxy]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 167444503 |
| Molecular Formula | C24H21N5O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-[[4-[(Z)-1-amino-3-methylimino-2-pyridin-4-ylprop-1-enyl]phenoxy]methyl]-3H-quinazolin-4-one |
| SMILES | C/N=C/C(=C(\N)c1ccc(OCc2nc3ccccc3c(=O)[nH]2)cc1)c1ccncc1 |
| InChI | InChI=1S/C24H21N5O2/c1-26-14-20(16-10-12-27-13-11-16)23(25)17-6-8-18(9-7-17)31-15-22-28-21-5-3-2-4-19(21)24(30)29-22/h2-14H,15,25H2,1H3,(H,28,29,30)/b23-20+,26-14+ |
| InChIKey | NBJJYSAPTPOFBX-OYBWUNPRSA-N |
| XLogP | 3.42 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|