C23H20F3N3O — CID 167444569
(Z)-1-(4-phenylmethoxyphenyl)-2-pyridin-4-yl-3-(2,2,2-trifluoroethylimino)prop-1-en-1-amine (PubChem CID 167444569) has the molecular formula C23H20F3N3O and a molecular weight of 411.43 g/mol. Its IUPAC name is (Z)-1-(4-phenylmethoxyphenyl)-2-pyridin-4-yl-3-(2,2,2-trifluoroethylimino)prop-1-en-1-amine.
| Compound Name | (Z)-1-(4-phenylmethoxyphenyl)-2-pyridin-4-yl-3-(2,2,2-trifluoroethylimino)prop-1-en-1-amine |
|---|---|
| PubChem CID | 167444569 |
| Molecular Formula | C23H20F3N3O |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (Z)-1-(4-phenylmethoxyphenyl)-2-pyridin-4-yl-3-(2,2,2-trifluoroethylimino)prop-1-en-1-amine |
| SMILES | N/C(=C(\C=N\CC(F)(F)F)c1ccncc1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H20F3N3O/c24-23(25,26)16-29-14-21(18-10-12-28-13-11-18)22(27)19-6-8-20(9-7-19)30-15-17-4-2-1-3-5-17/h1-14H,15-16,27H2/b22-21+,29-14+ |
| InChIKey | QWQUDFDQLNOLBO-LLIHPHMNSA-N |
| XLogP | 5.12 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|