C24H20F6N4OS — CID 163450119
3-[1-amino-2-pyridin-4-yl-3-(2,2,2-trifluoroethylimino)prop-1-enyl]-N-(2,5-difluorophenyl)sulfanyl-2-fluoro-N-(methoxymethyl)aniline (PubChem CID 163450119) has the molecular formula C24H20F6N4OS and a molecular weight of 526.51 g/mol. Its IUPAC name is 3-[1-amino-2-pyridin-4-yl-3-(2,2,2-trifluoroethylimino)prop-1-enyl]-N-(2,5-difluorophenyl)sulfanyl-2-fluoro-N-(methoxymethyl)aniline.
| Compound Name | 3-[1-amino-2-pyridin-4-yl-3-(2,2,2-trifluoroethylimino)prop-1-enyl]-N-(2,5-difluorophenyl)sulfanyl-2-fluoro-N-(methoxymethyl)aniline |
|---|---|
| PubChem CID | 163450119 |
| Molecular Formula | C24H20F6N4OS |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 3-[1-amino-2-pyridin-4-yl-3-(2,2,2-trifluoroethylimino)prop-1-enyl]-N-(2,5-difluorophenyl)sulfanyl-2-fluoro-N-(methoxymethyl)aniline |
| SMILES | COCN(Sc1cc(F)ccc1F)c1cccc(C(N)=C(/C=N/CC(F)(F)F)c2ccncc2)c1F |
| InChI | InChI=1S/C24H20F6N4OS/c1-35-14-34(36-21-11-16(25)5-6-19(21)26)20-4-2-3-17(22(20)27)23(31)18(12-33-13-24(28,29)30)15-7-9-32-10-8-15/h2-12H,13-14,31H2,1H3/b23-18?,33-12+ |
| InChIKey | SVESNVMUDDPLQR-OUVSLJCFSA-N |
| XLogP | 6.08 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|