C17H16Br2O — CID 169094365
1-[(Z)-1,4-dibromobut-2-en-2-yl]-4-phenylmethoxybenzene (PubChem CID 169094365) has the molecular formula C17H16Br2O and a molecular weight of 396.12 g/mol. Its IUPAC name is 1-[(Z)-1,4-dibromobut-2-en-2-yl]-4-phenylmethoxybenzene.
| Compound Name | 1-[(Z)-1,4-dibromobut-2-en-2-yl]-4-phenylmethoxybenzene |
|---|---|
| PubChem CID | 169094365 |
| Molecular Formula | C17H16Br2O |
| Molecular Weight | 396.12 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | 1-[(Z)-1,4-dibromobut-2-en-2-yl]-4-phenylmethoxybenzene |
| SMILES | BrC/C=C(\CBr)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H16Br2O/c18-11-10-16(12-19)15-6-8-17(9-7-15)20-13-14-4-2-1-3-5-14/h1-10H,11-13H2/b16-10+ |
| InChIKey | HNCMRCCLHSOSPJ-MHWRWJLKSA-N |
| XLogP | 5.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.12 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|