C26H22N4O3 — CID 167444508
2-[[4-[(Z)-1-amino-3-methylimino-2-pyridin-4-ylprop-1-enyl]phenoxy]methyl]quinoline-4-carboxylic acid (PubChem CID 167444508) has the molecular formula C26H22N4O3 and a molecular weight of 438.49 g/mol. Its IUPAC name is 2-[[4-[(Z)-1-amino-3-methylimino-2-pyridin-4-ylprop-1-enyl]phenoxy]methyl]quinoline-4-carboxylic acid.
| Compound Name | 2-[[4-[(Z)-1-amino-3-methylimino-2-pyridin-4-ylprop-1-enyl]phenoxy]methyl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 167444508 |
| Molecular Formula | C26H22N4O3 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 2-[[4-[(Z)-1-amino-3-methylimino-2-pyridin-4-ylprop-1-enyl]phenoxy]methyl]quinoline-4-carboxylic acid |
| SMILES | C/N=C/C(=C(\N)c1ccc(OCc2cc(C(=O)O)c3ccccc3n2)cc1)c1ccncc1 |
| InChI | InChI=1S/C26H22N4O3/c1-28-15-23(17-10-12-29-13-11-17)25(27)18-6-8-20(9-7-18)33-16-19-14-22(26(31)32)21-4-2-3-5-24(21)30-19/h2-15H,16,27H2,1H3,(H,31,32)/b25-23+,28-15+ |
| InChIKey | JYGPURGTSYTBPY-ZRAQYNDPSA-N |
| XLogP | 4.43 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|