C30H30N4O3 — CID 174037470
tert-butyl 2-[[4-(1-amino-3-methylimino-2-pyridin-4-ylprop-1-enyl)phenoxy]methyl]quinoline-4-carboxylate (PubChem CID 174037470) has the molecular formula C30H30N4O3 and a molecular weight of 494.60 g/mol. Its IUPAC name is tert-butyl 2-[[4-(1-amino-3-methylimino-2-pyridin-4-ylprop-1-enyl)phenoxy]methyl]quinoline-4-carboxylate.
| Compound Name | tert-butyl 2-[[4-(1-amino-3-methylimino-2-pyridin-4-ylprop-1-enyl)phenoxy]methyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 174037470 |
| Molecular Formula | C30H30N4O3 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | tert-butyl 2-[[4-(1-amino-3-methylimino-2-pyridin-4-ylprop-1-enyl)phenoxy]methyl]quinoline-4-carboxylate |
| SMILES | C/N=C/C(=C(N)c1ccc(OCc2cc(C(=O)OC(C)(C)C)c3ccccc3n2)cc1)c1ccncc1 |
| InChI | InChI=1S/C30H30N4O3/c1-30(2,3)37-29(35)25-17-22(34-27-8-6-5-7-24(25)27)19-36-23-11-9-21(10-12-23)28(31)26(18-32-4)20-13-15-33-16-14-20/h5-18H,19,31H2,1-4H3/b28-26?,32-18+ |
| InChIKey | RWKKERJJKYWKKO-WLNQSQOBSA-N |
| XLogP | 5.69 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|