C13H16Cl3N3O2 — CID 137153234
N-[(E)-1H-pyrrol-2-ylmethylideneamino]-2-(2,4,6-trichlorocyclohexyl)oxyacetamide (PubChem CID 137153234) has the molecular formula C13H16Cl3N3O2 and a molecular weight of 352.65 g/mol. Its IUPAC name is N-[(E)-1H-pyrrol-2-ylmethylideneamino]-2-(2,4,6-trichlorocyclohexyl)oxyacetamide.
| Compound Name | N-[(E)-1H-pyrrol-2-ylmethylideneamino]-2-(2,4,6-trichlorocyclohexyl)oxyacetamide |
|---|---|
| PubChem CID | 137153234 |
| Molecular Formula | C13H16Cl3N3O2 |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | N-[(E)-1H-pyrrol-2-ylmethylideneamino]-2-(2,4,6-trichlorocyclohexyl)oxyacetamide |
| SMILES | O=C(COC1C(Cl)CC(Cl)CC1Cl)N/N=C/c1ccc[nH]1 |
| InChI | InChI=1S/C13H16Cl3N3O2/c14-8-4-10(15)13(11(16)5-8)21-7-12(20)19-18-6-9-2-1-3-17-9/h1-3,6,8,10-11,13,17H,4-5,7H2,(H,19,20)/b18-6+ |
| InChIKey | ISCUHXHOLYXVDN-NGYBGAFCSA-N |
| XLogP | 2.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|