C26H27N5 — CID 137153838
N-[[3-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-5-ethyl-2-methylphenyl]methyl]ethanamine (PubChem CID 137153838) has the molecular formula C26H27N5 and a molecular weight of 409.54 g/mol. Its IUPAC name is N-[[3-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-5-ethyl-2-methylphenyl]methyl]ethanamine.
| Compound Name | N-[[3-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-5-ethyl-2-methylphenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 137153838 |
| Molecular Formula | C26H27N5 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | N-[[3-[3-(1H-benzimidazol-2-yl)-1H-indazol-5-yl]-5-ethyl-2-methylphenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(CC)cc(-c2ccc3[nH]nc(-c4nc5ccccc5[nH]4)c3c2)c1C |
| InChI | InChI=1S/C26H27N5/c1-4-17-12-19(15-27-5-2)16(3)20(13-17)18-10-11-22-21(14-18)25(31-30-22)26-28-23-8-6-7-9-24(23)29-26/h6-14,27H,4-5,15H2,1-3H3,(H,28,29)(H,30,31) |
| InChIKey | QIKBJVSTZLQISH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |