C27H27F3N3O2Si+ — CID 137153981
4-[5-[5-(cyclohexatrienyl)-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenol (PubChem CID 137153981) has the molecular formula C27H27F3N3O2Si+ and a molecular weight of 510.61 g/mol. Its IUPAC name is 4-[5-[5-(cyclohexatrienyl)-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenol.
| Compound Name | 4-[5-[5-(cyclohexatrienyl)-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 137153981 |
| Molecular Formula | C27H27F3N3O2Si+ |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 4-[5-[5-(cyclohexatrienyl)-4-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-2-pyridinyl]phenol |
| SMILES | C[Si](C)(C)CCOCn1c(-c2ccc(-c3ccc(O)cc3)nc2)nc(C(F)(F)F)c1C1=CC=[C+]C=C1 |
| InChI | InChI=1S/C27H26F3N3O2Si/c1-36(2,3)16-15-35-18-33-24(20-7-5-4-6-8-20)25(27(28,29)30)32-26(33)21-11-14-23(31-17-21)19-9-12-22(34)13-10-19/h5-14,17H,15-16,18H2,1-3H3/p+1 |
| InChIKey | BVLWNJCYIBMVMQ-UHFFFAOYSA-O |
| XLogP | 6.96 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|