C12H17N3O4 — CID 137154260
ethyl 2-[[6-(N'-hydroxycarbamimidoyl)-3-pyridinyl]oxy]butanoate (PubChem CID 137154260) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is ethyl 2-[[6-(N'-hydroxycarbamimidoyl)-3-pyridinyl]oxy]butanoate.
| Compound Name | ethyl 2-[[6-(N'-hydroxycarbamimidoyl)-3-pyridinyl]oxy]butanoate |
|---|---|
| PubChem CID | 137154260 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | ethyl 2-[[6-(N'-hydroxycarbamimidoyl)-3-pyridinyl]oxy]butanoate |
| SMILES | CCOC(=O)C(CC)Oc1ccc(C(N)=NO)nc1 |
| InChI | InChI=1S/C12H17N3O4/c1-3-10(12(16)18-4-2)19-8-5-6-9(14-7-8)11(13)15-17/h5-7,10,17H,3-4H2,1-2H3,(H2,13,15) |
| InChIKey | NNUHNOZLOIDZIF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|