About 2-[(2-aminocyclohexyl)amino]-4-(1-ethylpyrazol-4-yl)-6H-pyrrolo[3,4-d]pyrimidin-5-ol
2-[(2-aminocyclohexyl)amino]-4-(1-ethylpyrazol-4-yl)-6H-pyrrolo[3,4-d]pyrimidin-5-ol (PubChem CID 137154468) has the molecular formula C17H23N7O
and a molecular weight of 341.42 g/mol. Its IUPAC name is 2-[(2-aminocyclohexyl)amino]-4-(1-ethylpyrazol-4-yl)-6H-pyrrolo[3,4-d]pyrimidin-5-ol.
Molecular Properties
| Compound Name | 2-[(2-aminocyclohexyl)amino]-4-(1-ethylpyrazol-4-yl)-6H-pyrrolo[3,4-d]pyrimidin-5-ol |
| PubChem CID | 137154468 |
| Molecular Formula | C17H23N7O |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-[(2-aminocyclohexyl)amino]-4-(1-ethylpyrazol-4-yl)-6H-pyrrolo[3,4-d]pyrimidin-5-ol |
| SMILES | CCn1cc(-c2nc(NC3CCCCC3N)nc3c[nH]c(O)c23)cn1 |
| InChI | InChI=1S/C17H23N7O/c1-2-24-9-10(7-20-24)15-14-13(8-19-16(14)25)22-17(23-15)21-12-6-4-3-5-11(12)18/h7-9,11-12,19,25H,2-6,18H2,1H3,(H,21,22) |
| InChIKey | YDLGXEBOLICQSW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(2-aminocyclohexyl)amino]-4-(1-ethylpyrazol-4-yl)-6H-pyrrolo[3,4-d]pyrimidin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-aminocyclohexyl)amino]-4-(1-ethylpyrazol-4-yl)-6H-pyrrolo[3,4-d]pyrimidin-5-ol?
The IUPAC name of 2-[(2-aminocyclohexyl)amino]-4-(1-ethylpyrazol-4-yl)-6H-pyrrolo[3,4-d]pyrimidin-5-ol (CID 137154468) is 2-[(2-aminocyclohexyl)amino]-4-(1-ethylpyrazol-4-yl)-6H-pyrrolo[3,4-d]pyrimidin-5-ol.
What is the SMILES notation for 2-[(2-aminocyclohexyl)amino]-4-(1-ethylpyrazol-4-yl)-6H-pyrrolo[3,4-d]pyrimidin-5-ol?
The canonical SMILES for 2-[(2-aminocyclohexyl)amino]-4-(1-ethylpyrazol-4-yl)-6H-pyrrolo[3,4-d]pyrimidin-5-ol is CCn1cc(-c2nc(NC3CCCCC3N)nc3c[nH]c(O)c23)cn1.
What is the InChIKey of 2-[(2-aminocyclohexyl)amino]-4-(1-ethylpyrazol-4-yl)-6H-pyrrolo[3,4-d]pyrimidin-5-ol?
The InChIKey is YDLGXEBOLICQSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N7O/c1-2-24-9-10(7-20-24)15-14-13(8-19-16(14)25)22-17(23-15)21-12-6-4-3-5-11(12)18/h7-9,11-12,19,25H,2-6,18H2,1H3,(H,21,22).
What are the key properties of 2-[(2-aminocyclohexyl)amino]-4-(1-ethylpyrazol-4-yl)-6H-pyrrolo[3,4-d]pyrimidin-5-ol?
2-[(2-aminocyclohexyl)amino]-4-(1-ethylpyrazol-4-yl)-6H-pyrrolo[3,4-d]pyrimidin-5-ol has a molecular weight of 341.42 g/mol, XLogP of 2.23, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-aminocyclohexyl)amino]-4-(1-ethylpyrazol-4-yl)-6H-pyrrolo[3,4-d]pyrimidin-5-ol is sourced from PubChem (CID 137154468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).