C16H13FN4O — CID 137155005
2-fluoro-4-[5-(1-iminobut-2-en-2-yl)-2-methyl-6-oxo-1H-pyrimidin-4-yl]benzonitrile (PubChem CID 137155005) has the molecular formula C16H13FN4O and a molecular weight of 296.31 g/mol. Its IUPAC name is 2-fluoro-4-[5-(1-iminobut-2-en-2-yl)-2-methyl-6-oxo-1H-pyrimidin-4-yl]benzonitrile.
| Compound Name | 2-fluoro-4-[5-(1-iminobut-2-en-2-yl)-2-methyl-6-oxo-1H-pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 137155005 |
| Molecular Formula | C16H13FN4O |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-fluoro-4-[5-(1-iminobut-2-en-2-yl)-2-methyl-6-oxo-1H-pyrimidin-4-yl]benzonitrile |
| SMILES | [H]/N=C/C(=CC)c1c(-c2ccc(C#N)c(F)c2)nc(C)[nH]c1=O |
| InChI | InChI=1S/C16H13FN4O/c1-3-10(7-18)14-15(20-9(2)21-16(14)22)11-4-5-12(8-19)13(17)6-11/h3-7,18H,1-2H3,(H,20,21,22)/b10-3?,18-7+ |
| InChIKey | UHMFCXFAIKJNLA-CVKLMGNRSA-N |
| XLogP | 2.81 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|