C17H22N2O2S2 — CID 137161992
4-cyclopropyl-2-[5-(2,2-dimethylpropylidene-methyl-oxo-λ6-sulfanyl)thiophen-2-yl]-1H-pyrimidin-6-one (PubChem CID 137161992) has the molecular formula C17H22N2O2S2 and a molecular weight of 350.51 g/mol. Its IUPAC name is 4-cyclopropyl-2-[5-(2,2-dimethylpropylidene-methyl-oxo-λ6-sulfanyl)thiophen-2-yl]-1H-pyrimidin-6-one.
| Compound Name | 4-cyclopropyl-2-[5-(2,2-dimethylpropylidene-methyl-oxo-λ6-sulfanyl)thiophen-2-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137161992 |
| Molecular Formula | C17H22N2O2S2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-cyclopropyl-2-[5-(2,2-dimethylpropylidene-methyl-oxo-λ6-sulfanyl)thiophen-2-yl]-1H-pyrimidin-6-one |
| SMILES | CC(C)(C)C=S(C)(=O)c1ccc(-c2nc(C3CC3)cc(=O)[nH]2)s1 |
| InChI | InChI=1S/C17H22N2O2S2/c1-17(2,3)10-23(4,21)15-8-7-13(22-15)16-18-12(11-5-6-11)9-14(20)19-16/h7-11H,5-6H2,1-4H3,(H,18,19,20) |
| InChIKey | GFJIIIPSDAADGO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|