C23H27N3OS — CID 1371628
2-[(3'R,4R)-3-cyano-3'-methylspiro[1,5,6,7-tetrahydrocyclopenta[b]pyridine-4,1'-cyclohexane]-2-yl]sulfanyl-N-phenylacetamide (PubChem CID 1371628) has the molecular formula C23H27N3OS and a molecular weight of 393.56 g/mol. Its IUPAC name is 2-[(3'R,4R)-3-cyano-3'-methylspiro[1,5,6,7-tetrahydrocyclopenta[b]pyridine-4,1'-cyclohexane]-2-yl]sulfanyl-N-phenylacetamide.
| Compound Name | 2-[(3'R,4R)-3-cyano-3'-methylspiro[1,5,6,7-tetrahydrocyclopenta[b]pyridine-4,1'-cyclohexane]-2-yl]sulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 1371628 |
| Molecular Formula | C23H27N3OS |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 2-[(3'R,4R)-3-cyano-3'-methylspiro[1,5,6,7-tetrahydrocyclopenta[b]pyridine-4,1'-cyclohexane]-2-yl]sulfanyl-N-phenylacetamide |
| SMILES | C[C@@H]1CCC[C@]2(C1)C(C#N)=C(SCC(=O)Nc1ccccc1)NC1=C2CCC1 |
| InChI | InChI=1S/C23H27N3OS/c1-16-7-6-12-23(13-16)18-10-5-11-20(18)26-22(19(23)14-24)28-15-21(27)25-17-8-3-2-4-9-17/h2-4,8-9,16,26H,5-7,10-13,15H2,1H3,(H,25,27)/t16-,23-/m1/s1 |
| InChIKey | PYGIGQXNGKWUKF-WAIKUNEKSA-N |
| XLogP | 5.33 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |