C24H20N4O2S — CID 137165922
(5Z)-5-[(4-hydroxyphenyl)methylidene]-2-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 137165922) has the molecular formula C24H20N4O2S and a molecular weight of 428.52 g/mol. Its IUPAC name is (5Z)-5-[(4-hydroxyphenyl)methylidene]-2-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(4-hydroxyphenyl)methylidene]-2-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137165922 |
| Molecular Formula | C24H20N4O2S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (5Z)-5-[(4-hydroxyphenyl)methylidene]-2-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccccc1/N=N/c1ccc(/N=C2\NC(=O)/C(=C/c3ccc(O)cc3)S2)c(C)c1 |
| InChI | InChI=1S/C24H20N4O2S/c1-15-5-3-4-6-21(15)28-27-18-9-12-20(16(2)13-18)25-24-26-23(30)22(31-24)14-17-7-10-19(29)11-8-17/h3-14,29H,1-2H3,(H,25,26,30)/b22-14-,28-27+ |
| InChIKey | LXVVFXYJXMFLEM-ACYHEVRDSA-N |
| XLogP | 6.32 |
| TPSA | 86.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|