C26H25N5OS — CID 137165917
(5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-2-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]imino-1,3-thiazolidin-4-one (PubChem CID 137165917) has the molecular formula C26H25N5OS and a molecular weight of 455.59 g/mol. Its IUPAC name is (5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-2-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-2-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137165917 |
| Molecular Formula | C26H25N5OS |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | (5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-2-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccccc1/N=N/c1ccc(/N=C2\NC(=O)/C(=C/c3ccc(N(C)C)cc3)S2)c(C)c1 |
| InChI | InChI=1S/C26H25N5OS/c1-17-7-5-6-8-23(17)30-29-20-11-14-22(18(2)15-20)27-26-28-25(32)24(33-26)16-19-9-12-21(13-10-19)31(3)4/h5-16H,1-4H3,(H,27,28,32)/b24-16-,30-29+ |
| InChIKey | PAOKEHOEOYVKDJ-CRSXJLIYSA-N |
| XLogP | 6.68 |
| TPSA | 69.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|