C17H19N5O — CID 137169810
N-[[4-(dimethylamino)phenyl]methyl]-3-(1H-pyrrol-2-yl)-1H-pyrazole-5-carboxamide (PubChem CID 137169810) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-3-(1H-pyrrol-2-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-3-(1H-pyrrol-2-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 137169810 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-3-(1H-pyrrol-2-yl)-1H-pyrazole-5-carboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)c2cc(-c3ccc[nH]3)n[nH]2)cc1 |
| InChI | InChI=1S/C17H19N5O/c1-22(2)13-7-5-12(6-8-13)11-19-17(23)16-10-15(20-21-16)14-4-3-9-18-14/h3-10,18H,11H2,1-2H3,(H,19,23)(H,20,21) |
| InChIKey | LNXHPCFRXAXIAH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 76.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|