C14H17N3O — CID 110470852
N-[[3-(dimethylamino)phenyl]methyl]-1H-pyrrole-2-carboxamide (PubChem CID 110470852) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is N-[[3-(dimethylamino)phenyl]methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[[3-(dimethylamino)phenyl]methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 110470852 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-[[3-(dimethylamino)phenyl]methyl]-1H-pyrrole-2-carboxamide |
| SMILES | CN(C)c1cccc(CNC(=O)c2ccc[nH]2)c1 |
| InChI | InChI=1S/C14H17N3O/c1-17(2)12-6-3-5-11(9-12)10-16-14(18)13-7-4-8-15-13/h3-9,15H,10H2,1-2H3,(H,16,18) |
| InChIKey | FOLOPPAHXBVTHS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |